C8H11ClS — CID 143911288
(3Z,5E)-5-chloro-2-methylsulfanylhepta-1,3,5-triene (PubChem CID 143911288) has the molecular formula C8H11ClS and a molecular weight of 174.70 g/mol. Its IUPAC name is (3Z,5E)-5-chloro-2-methylsulfanylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-chloro-2-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143911288 |
| Molecular Formula | C8H11ClS |
| Molecular Weight | 174.70 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (3Z,5E)-5-chloro-2-methylsulfanylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(Cl)=C/C)SC |
| InChI | InChI=1S/C8H11ClS/c1-4-8(9)6-5-7(2)10-3/h4-6H,2H2,1,3H3/b6-5-,8-4+ |
| InChIKey | HSUSQSIWLIOEAR-QNMAEOQASA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|