C9H16OS — CID 143911299
(2E,4E)-2-methoxy-5-methylsulfanylhepta-2,4-diene (PubChem CID 143911299) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is (2E,4E)-2-methoxy-5-methylsulfanylhepta-2,4-diene.
| Compound Name | (2E,4E)-2-methoxy-5-methylsulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 143911299 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (2E,4E)-2-methoxy-5-methylsulfanylhepta-2,4-diene |
| SMILES | CC/C(=C\C=C(/C)OC)SC |
| InChI | InChI=1S/C9H16OS/c1-5-9(11-4)7-6-8(2)10-3/h6-7H,5H2,1-4H3/b8-6+,9-7+ |
| InChIKey | GNEASJDWBDTDMZ-CDJQDVQCSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|