About 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane
2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane (PubChem CID 143911413) has the molecular formula C12H19ClN2O2S
and a molecular weight of 290.82 g/mol. Its IUPAC name is 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane.
Molecular Properties
| Compound Name | 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane |
| PubChem CID | 143911413 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane |
| SMILES | CCOC.CSc1ncc(C(C)(C)C=O)c(Cl)n1 |
| InChI | InChI=1S/C9H11ClN2OS.C3H8O/c1-9(2,5-13)6-4-11-8(14-3)12-7(6)10;1-3-4-2/h4-5H,1-3H3;3H2,1-2H3 |
| InChIKey | HERNSWGXALDITG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane?
The IUPAC name of 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane (CID 143911413) is 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane.
What is the SMILES notation for 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane?
The canonical SMILES for 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane is CCOC.CSc1ncc(C(C)(C)C=O)c(Cl)n1.
What is the InChIKey of 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane?
The InChIKey is HERNSWGXALDITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2OS.C3H8O/c1-9(2,5-13)6-4-11-8(14-3)12-7(6)10;1-3-4-2/h4-5H,1-3H3;3H2,1-2H3.
What are the key properties of 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane?
2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane has a molecular weight of 290.82 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-methylsulfanylpyrimidin-5-yl)-2-methylpropanal;methoxyethane is sourced from PubChem (CID 143911413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).