About ethane;9-methylpurin-2-amine
ethane;9-methylpurin-2-amine (PubChem CID 143911812) has the molecular formula C8H13N5
and a molecular weight of 179.23 g/mol. Its IUPAC name is ethane;9-methylpurin-2-amine.
Molecular Properties
| Compound Name | ethane;9-methylpurin-2-amine |
| PubChem CID | 143911812 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | ethane;9-methylpurin-2-amine |
| SMILES | CC.Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C6H7N5.C2H6/c1-11-3-9-4-2-8-6(7)10-5(4)11;1-2/h2-3H,1H3,(H2,7,8,10);1-2H3 |
| InChIKey | NLPPBGISNVAVJZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;9-methylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-methylpurin-2-amine?
The IUPAC name of ethane;9-methylpurin-2-amine (CID 143911812) is ethane;9-methylpurin-2-amine.
What is the SMILES notation for ethane;9-methylpurin-2-amine?
The canonical SMILES for ethane;9-methylpurin-2-amine is CC.Cn1cnc2cnc(N)nc21.
What is the InChIKey of ethane;9-methylpurin-2-amine?
The InChIKey is NLPPBGISNVAVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5.C2H6/c1-11-3-9-4-2-8-6(7)10-5(4)11;1-2/h2-3H,1H3,(H2,7,8,10);1-2H3.
What are the key properties of ethane;9-methylpurin-2-amine?
ethane;9-methylpurin-2-amine has a molecular weight of 179.23 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-methylpurin-2-amine is sourced from PubChem (CID 143911812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).