C20H32N2 — CID 143912687
ethane;[(2E,4E)-5-[(6E)-2-ethenyl-6-prop-2-enylidenecyclohexen-1-yl]hepta-2,4-dien-2-yl]hydrazine (PubChem CID 143912687) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is ethane;[(2E,4E)-5-[(6E)-2-ethenyl-6-prop-2-enylidenecyclohexen-1-yl]hepta-2,4-dien-2-yl]hydrazine.
| Compound Name | ethane;[(2E,4E)-5-[(6E)-2-ethenyl-6-prop-2-enylidenecyclohexen-1-yl]hepta-2,4-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 143912687 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | ethane;[(2E,4E)-5-[(6E)-2-ethenyl-6-prop-2-enylidenecyclohexen-1-yl]hepta-2,4-dien-2-yl]hydrazine |
| SMILES | C=C/C=C1\CCCC(C=C)=C1/C(=C/C=C(\C)NN)CC.CC |
| InChI | InChI=1S/C18H26N2.C2H6/c1-5-9-17-11-8-10-15(6-2)18(17)16(7-3)13-12-14(4)20-19;1-2/h5-6,9,12-13,20H,1-2,7-8,10-11,19H2,3-4H3;1-2H3/b14-12+,16-13+,17-9+; |
| InChIKey | HFZTZHXJPCAJOD-SMIPSNRPSA-N |
| XLogP | 5.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|