C29H46N4O2 — CID 143912780
cyclohexane;2,8-diazaspiro[4.5]decane;(2S)-N-(2,3-dihydro-1H-inden-1-yl)-1-formylpyrrolidine-2-carboxamide (PubChem CID 143912780) has the molecular formula C29H46N4O2 and a molecular weight of 482.71 g/mol. Its IUPAC name is cyclohexane;2,8-diazaspiro[4.5]decane;(2S)-N-(2,3-dihydro-1H-inden-1-yl)-1-formylpyrrolidine-2-carboxamide.
| Compound Name | cyclohexane;2,8-diazaspiro[4.5]decane;(2S)-N-(2,3-dihydro-1H-inden-1-yl)-1-formylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143912780 |
| Molecular Formula | C29H46N4O2 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | cyclohexane;2,8-diazaspiro[4.5]decane;(2S)-N-(2,3-dihydro-1H-inden-1-yl)-1-formylpyrrolidine-2-carboxamide |
| SMILES | C1CC2(CCN1)CCNC2.C1CCCCC1.O=CN1CCC[C@H]1C(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C15H18N2O2.C8H16N2.C6H12/c18-10-17-9-3-6-14(17)15(19)16-13-8-7-11-4-1-2-5-12(11)13;1-4-9-5-2-8(1)3-6-10-7-8;1-2-4-6-5-3-1/h1-2,4-5,10,13-14H,3,6-9H2,(H,16,19);9-10H,1-7H2;1-6H2/t13?,14-;;/m0../s1 |
| InChIKey | GUUXDJFKASEQEP-HNYZGNTBSA-N |
| XLogP | 4.10 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|