About 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile
8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile (PubChem CID 143912852) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile |
| PubChem CID | 143912852 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile |
| SMILES | CC1CCC2(CN1)CNC(C#N)C2 |
| InChI | InChI=1S/C10H17N3/c1-8-2-3-10(6-12-8)4-9(5-11)13-7-10/h8-9,12-13H,2-4,6-7H2,1H3 |
| InChIKey | QZALYYPXHMYVNQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile?
The IUPAC name of 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile (CID 143912852) is 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile.
What is the SMILES notation for 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile?
The canonical SMILES for 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile is CC1CCC2(CN1)CNC(C#N)C2.
What is the InChIKey of 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile?
The InChIKey is QZALYYPXHMYVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-8-2-3-10(6-12-8)4-9(5-11)13-7-10/h8-9,12-13H,2-4,6-7H2,1H3.
What are the key properties of 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile?
8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile has a molecular weight of 179.27 g/mol, XLogP of 0.63, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,9-diazaspiro[4.5]decane-3-carbonitrile is sourced from PubChem (CID 143912852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).