C23H23N5O2S — CID 143913326
4-[[7-(1-methylpiperidin-4-yl)oxy-6-(1,3-thiazol-2-yl)quinazolin-2-yl]amino]phenol (PubChem CID 143913326) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-[[7-(1-methylpiperidin-4-yl)oxy-6-(1,3-thiazol-2-yl)quinazolin-2-yl]amino]phenol.
| Compound Name | 4-[[7-(1-methylpiperidin-4-yl)oxy-6-(1,3-thiazol-2-yl)quinazolin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 143913326 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-[[7-(1-methylpiperidin-4-yl)oxy-6-(1,3-thiazol-2-yl)quinazolin-2-yl]amino]phenol |
| SMILES | CN1CCC(Oc2cc3nc(Nc4ccc(O)cc4)ncc3cc2-c2nccs2)CC1 |
| InChI | InChI=1S/C23H23N5O2S/c1-28-9-6-18(7-10-28)30-21-13-20-15(12-19(21)22-24-8-11-31-22)14-25-23(27-20)26-16-2-4-17(29)5-3-16/h2-5,8,11-14,18,29H,6-7,9-10H2,1H3,(H,25,26,27) |
| InChIKey | AOZGQXJYCDIVQO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|