C24H26N6O2S2 — CID 143913419
[2-[2-[3-(methylsulfanylamino)anilino]-7-piperidin-4-yloxyquinazolin-6-yl]-1,3-thiazol-4-yl]methanol (PubChem CID 143913419) has the molecular formula C24H26N6O2S2 and a molecular weight of 494.65 g/mol. Its IUPAC name is [2-[2-[3-(methylsulfanylamino)anilino]-7-piperidin-4-yloxyquinazolin-6-yl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-[2-[3-(methylsulfanylamino)anilino]-7-piperidin-4-yloxyquinazolin-6-yl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 143913419 |
| Molecular Formula | C24H26N6O2S2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [2-[2-[3-(methylsulfanylamino)anilino]-7-piperidin-4-yloxyquinazolin-6-yl]-1,3-thiazol-4-yl]methanol |
| SMILES | CSNc1cccc(Nc2ncc3cc(-c4nc(CO)cs4)c(OC4CCNCC4)cc3n2)c1 |
| InChI | InChI=1S/C24H26N6O2S2/c1-33-30-17-4-2-3-16(10-17)28-24-26-12-15-9-20(23-27-18(13-31)14-34-23)22(11-21(15)29-24)32-19-5-7-25-8-6-19/h2-4,9-12,14,19,25,30-31H,5-8,13H2,1H3,(H,26,28,29) |
| InChIKey | RKWDHDHYQFASRR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|