C23H25N5O4 — CID 143913582
5-(2,4-dimorpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl)-2-methoxybenzaldehyde (PubChem CID 143913582) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 5-(2,4-dimorpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl)-2-methoxybenzaldehyde.
| Compound Name | 5-(2,4-dimorpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl)-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 143913582 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 5-(2,4-dimorpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl)-2-methoxybenzaldehyde |
| SMILES | COc1ccc(-c2ccc3c(N4CCOCC4)nc(N4CCOCC4)nc3n2)cc1C=O |
| InChI | InChI=1S/C23H25N5O4/c1-30-20-5-2-16(14-17(20)15-29)19-4-3-18-21(24-19)25-23(28-8-12-32-13-9-28)26-22(18)27-6-10-31-11-7-27/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | MWBUVQLTIOAVEH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|