4,8-dimethylnon-7-enoic acid

C11H20O2 — CID 14391383

IUPAC4,8-dimethylnon-7-enoic acid
SMILESCC(C)=CCCC(C)CCC(=O)O
InChIInChI=1S/C11H20O2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,10H,4,6-8H2,1-3H3,(H,12,13)
InChIKeyVMDADXVJUBKTJB-UHFFFAOYSA-N
MW184.28 g/mol
LogP3.23
Rot. Bonds6

About 4,8-dimethylnon-7-enoic acid

4,8-dimethylnon-7-enoic acid (PubChem CID 14391383) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 4,8-dimethylnon-7-enoic acid.

Molecular Properties

Compound Name4,8-dimethylnon-7-enoic acid
PubChem CID14391383
Molecular FormulaC11H20O2
Molecular Weight184.28 g/mol
Exact Mass184.15
IUPAC Name4,8-dimethylnon-7-enoic acid
SMILESCC(C)=CCCC(C)CCC(=O)O
InChIInChI=1S/C11H20O2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,10H,4,6-8H2,1-3H3,(H,12,13)
InChIKeyVMDADXVJUBKTJB-UHFFFAOYSA-N
XLogP3.23
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.28
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4,8-dimethylnon-7-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,8-dimethylnon-7-enoic acid?
The IUPAC name of 4,8-dimethylnon-7-enoic acid (CID 14391383) is 4,8-dimethylnon-7-enoic acid.
What is the SMILES notation for 4,8-dimethylnon-7-enoic acid?
The canonical SMILES for 4,8-dimethylnon-7-enoic acid is CC(C)=CCCC(C)CCC(=O)O.
What is the InChIKey of 4,8-dimethylnon-7-enoic acid?
The InChIKey is VMDADXVJUBKTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,10H,4,6-8H2,1-3H3,(H,12,13).
What are the key properties of 4,8-dimethylnon-7-enoic acid?
4,8-dimethylnon-7-enoic acid has a molecular weight of 184.28 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylnon-7-enoic acid is sourced from PubChem (CID 14391383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).