About 4,8-dimethylnon-7-enoic acid
4,8-dimethylnon-7-enoic acid (PubChem CID 14391383) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4,8-dimethylnon-7-enoic acid.
Molecular Properties
| Compound Name | 4,8-dimethylnon-7-enoic acid |
| PubChem CID | 14391383 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 4,8-dimethylnon-7-enoic acid |
| SMILES | CC(C)=CCCC(C)CCC(=O)O |
| InChI | InChI=1S/C11H20O2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,10H,4,6-8H2,1-3H3,(H,12,13) |
| InChIKey | VMDADXVJUBKTJB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dimethylnon-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylnon-7-enoic acid?
The IUPAC name of 4,8-dimethylnon-7-enoic acid (CID 14391383) is 4,8-dimethylnon-7-enoic acid.
What is the SMILES notation for 4,8-dimethylnon-7-enoic acid?
The canonical SMILES for 4,8-dimethylnon-7-enoic acid is CC(C)=CCCC(C)CCC(=O)O.
What is the InChIKey of 4,8-dimethylnon-7-enoic acid?
The InChIKey is VMDADXVJUBKTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,10H,4,6-8H2,1-3H3,(H,12,13).
What are the key properties of 4,8-dimethylnon-7-enoic acid?
4,8-dimethylnon-7-enoic acid has a molecular weight of 184.28 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylnon-7-enoic acid is sourced from PubChem (CID 14391383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).