About 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane
3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane (PubChem CID 143913843) has the molecular formula C20H32N2O
and a molecular weight of 316.49 g/mol. Its IUPAC name is 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane |
| PubChem CID | 143913843 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane |
| SMILES | C=CC(=C)CCn1c(CN2CCCC2)c(C)cc(C)c1=O.CC |
| InChI | InChI=1S/C18H26N2O.C2H6/c1-5-14(2)8-11-20-17(13-19-9-6-7-10-19)15(3)12-16(4)18(20)21;1-2/h5,12H,1-2,6-11,13H2,3-4H3;1-2H3 |
| InChIKey | RVSZXKROGFWNQV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane?
The IUPAC name of 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane (CID 143913843) is 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane.
What is the SMILES notation for 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane?
The canonical SMILES for 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane is C=CC(=C)CCn1c(CN2CCCC2)c(C)cc(C)c1=O.CC.
What is the InChIKey of 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane?
The InChIKey is RVSZXKROGFWNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O.C2H6/c1-5-14(2)8-11-20-17(13-19-9-6-7-10-19)15(3)12-16(4)18(20)21;1-2/h5,12H,1-2,6-11,13H2,3-4H3;1-2H3.
What are the key properties of 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane?
3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane has a molecular weight of 316.49 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one;ethane is sourced from PubChem (CID 143913843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).