C28H45N7O3 — CID 143914258
N-(2-aminopropyl)-1-[6-(methylamino)hexyl]-N-[(5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]benzimidazole-2-carboxamide (PubChem CID 143914258) has the molecular formula C28H45N7O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-(2-aminopropyl)-1-[6-(methylamino)hexyl]-N-[(5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]benzimidazole-2-carboxamide.
| Compound Name | N-(2-aminopropyl)-1-[6-(methylamino)hexyl]-N-[(5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 143914258 |
| Molecular Formula | C28H45N7O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | N-(2-aminopropyl)-1-[6-(methylamino)hexyl]-N-[(5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]benzimidazole-2-carboxamide |
| SMILES | CNCCCCCCn1c(C(=O)N(CC(C)N)C2CNC[C@H](C(=O)N3CCOCC3)C2)nc2ccccc21 |
| InChI | InChI=1S/C28H45N7O3/c1-21(29)20-35(23-17-22(18-31-19-23)27(36)33-13-15-38-16-14-33)28(37)26-32-24-9-5-6-10-25(24)34(26)12-8-4-3-7-11-30-2/h5-6,9-10,21-23,30-31H,3-4,7-8,11-20,29H2,1-2H3/t21?,22-,23?/m1/s1 |
| InChIKey | YGFHVNZJPIRUIB-OOMBGRCJSA-N |
| XLogP | 1.44 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|