C25H40N4O4 — CID 143914531
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-(prop-2-enylamino)carbamimidoyl]phenyl]ethoxy]propanamide (PubChem CID 143914531) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-(prop-2-enylamino)carbamimidoyl]phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-(prop-2-enylamino)carbamimidoyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 143914531 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[(Z)-N'-(prop-2-enylamino)carbamimidoyl]phenyl]ethoxy]propanamide |
| SMILES | C=CCN/N=C(\N)c1cccc(CCOCCC(=O)N(CC(OC)OC)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H40N4O4/c1-4-15-27-28-25(26)21-10-8-9-20(18-21)13-16-33-17-14-23(30)29(19-24(31-2)32-3)22-11-6-5-7-12-22/h4,8-10,18,22,24,27H,1,5-7,11-17,19H2,2-3H3,(H2,26,28) |
| InChIKey | YOFMIORAIIESAY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|