C15H28N2O2 — CID 143914958
ethane;(5E,6E)-3-methyl-5,6-di(propylidene)-1,3-diazinane-2,4-dione (PubChem CID 143914958) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is ethane;(5E,6E)-3-methyl-5,6-di(propylidene)-1,3-diazinane-2,4-dione.
| Compound Name | ethane;(5E,6E)-3-methyl-5,6-di(propylidene)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 143914958 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | ethane;(5E,6E)-3-methyl-5,6-di(propylidene)-1,3-diazinane-2,4-dione |
| SMILES | CC.CC.CC/C=c1/[nH]c(=O)n(C)c(=O)/c1=C/CC |
| InChI | InChI=1S/C11H16N2O2.2C2H6/c1-4-6-8-9(7-5-2)12-11(15)13(3)10(8)14;2*1-2/h6-7H,4-5H2,1-3H3,(H,12,15);2*1-2H3/b8-6+,9-7+;; |
| InChIKey | OWGDGPDDTHJGFU-IWBCLEKBSA-N |
| XLogP | 1.51 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |