C27H29N3O2 — CID 143915014
ethane;(6R)-4-(4-quinazolin-2-ylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 143915014) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is ethane;(6R)-4-(4-quinazolin-2-ylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | ethane;(6R)-4-(4-quinazolin-2-ylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 143915014 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | ethane;(6R)-4-(4-quinazolin-2-ylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC.CC.O=C1C2C3C=CC(C3)[C@H]2C(=O)N1c1ccc(-c2ncc3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H17N3O2.2C2H6/c27-22-19-14-5-6-15(11-14)20(19)23(28)26(22)17-9-7-13(8-10-17)21-24-12-16-3-1-2-4-18(16)25-21;2*1-2/h1-10,12,14-15,19-20H,11H2;2*1-2H3/t14?,15?,19-,20?;;/m1../s1 |
| InChIKey | HRSWMCJYNDGULW-MYNJTMTISA-N |
| XLogP | 5.66 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|