C8H11N2OP — CID 143916081
N,N-dimethyl-5-phosphanylpyridine-2-carboxamide (PubChem CID 143916081) has the molecular formula C8H11N2OP and a molecular weight of 182.16 g/mol. Its IUPAC name is N,N-dimethyl-5-phosphanylpyridine-2-carboxamide.
| Compound Name | N,N-dimethyl-5-phosphanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143916081 |
| Molecular Formula | C8H11N2OP |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | N,N-dimethyl-5-phosphanylpyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(P)cn1 |
| InChI | InChI=1S/C8H11N2OP/c1-10(2)8(11)7-4-3-6(12)5-9-7/h3-5H,12H2,1-2H3 |
| InChIKey | PKOKKTUZKVRXHQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|