C18H14FN5S — CID 143916247
N-(6-fluoro-3-pyridinyl)-5-(3-methylsulfanylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 143916247) has the molecular formula C18H14FN5S and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-5-(3-methylsulfanylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-(6-fluoro-3-pyridinyl)-5-(3-methylsulfanylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 143916247 |
| Molecular Formula | C18H14FN5S |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-5-(3-methylsulfanylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CSc1cccc(-c2cccc3nc(Nc4ccc(F)nc4)nn23)c1 |
| InChI | InChI=1S/C18H14FN5S/c1-25-14-5-2-4-12(10-14)15-6-3-7-17-22-18(23-24(15)17)21-13-8-9-16(19)20-11-13/h2-11H,1H3,(H,21,23) |
| InChIKey | JQLMANXQQQRLAZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|