C27H28F3N7O — CID 143916280
N-(3-piperazin-1-ylpropyl)-4-[[5-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide (PubChem CID 143916280) has the molecular formula C27H28F3N7O and a molecular weight of 523.56 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-4-[[5-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide.
| Compound Name | N-(3-piperazin-1-ylpropyl)-4-[[5-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 143916280 |
| Molecular Formula | C27H28F3N7O |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-4-[[5-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
| SMILES | O=C(NCCCN1CCNCC1)c1ccc(Nc2nc3cccc(-c4cccc(C(F)(F)F)c4)n3n2)cc1 |
| InChI | InChI=1S/C27H28F3N7O/c28-27(29,30)21-5-1-4-20(18-21)23-6-2-7-24-34-26(35-37(23)24)33-22-10-8-19(9-11-22)25(38)32-12-3-15-36-16-13-31-14-17-36/h1-2,4-11,18,31H,3,12-17H2,(H,32,38)(H,33,35) |
| InChIKey | GAZOAJMQTFMOLH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|