C31H53N3O5 — CID 143916406
(Z)-N-[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]pent-2-enamide;4-methylpiperazine-1-carboxylic acid;molecular hydrogen (PubChem CID 143916406) has the molecular formula C31H53N3O5 and a molecular weight of 547.78 g/mol. Its IUPAC name is (Z)-N-[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]pent-2-enamide;4-methylpiperazine-1-carboxylic acid;molecular hydrogen.
| Compound Name | (Z)-N-[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]pent-2-enamide;4-methylpiperazine-1-carboxylic acid;molecular hydrogen |
|---|---|
| PubChem CID | 143916406 |
| Molecular Formula | C31H53N3O5 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.40 |
| IUPAC Name | (Z)-N-[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]pent-2-enamide;4-methylpiperazine-1-carboxylic acid;molecular hydrogen |
| SMILES | CC/C=C\C(=O)NC1CCC(C/C=C(C)/C=C/[C@@H]2C[C@]3(CO3)CC(C)(C)O2)CC1.CN1CCN(C(=O)O)CC1.[H][H] |
| InChI | InChI=1S/C25H39NO3.C6H12N2O2.H2/c1-5-6-7-23(27)26-21-13-11-20(12-14-21)10-8-19(2)9-15-22-16-25(18-28-25)17-24(3,4)29-22;1-7-2-4-8(5-3-7)6(9)10;/h6-9,15,20-22H,5,10-14,16-18H2,1-4H3,(H,26,27);2-5H2,1H3,(H,9,10);1H/b7-6-,15-9+,19-8+;;/t20?,21?,22-,25-;;/m1../s1 |
| InChIKey | RTHASZBHHFDGSL-GIJKAVPFSA-N |
| XLogP | 5.40 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|