C31H49NOS — CID 143916623
ethane;2-heptan-4-yl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole;pent-1-en-1-one (PubChem CID 143916623) has the molecular formula C31H49NOS and a molecular weight of 483.81 g/mol. Its IUPAC name is ethane;2-heptan-4-yl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole;pent-1-en-1-one.
| Compound Name | ethane;2-heptan-4-yl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole;pent-1-en-1-one |
|---|---|
| PubChem CID | 143916623 |
| Molecular Formula | C31H49NOS |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | ethane;2-heptan-4-yl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole;pent-1-en-1-one |
| SMILES | CC.CCCC(CCC)c1nc(-c2ccc3c(c2)C(C)(C)CCC3(C)C)cs1.CCCC=C=O |
| InChI | InChI=1S/C24H35NS.C5H8O.C2H6/c1-7-9-17(10-8-2)22-25-21(16-26-22)18-11-12-19-20(15-18)24(5,6)14-13-23(19,3)4;1-2-3-4-5-6;1-2/h11-12,15-17H,7-10,13-14H2,1-6H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | GZVXOLWUCQYDLV-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|