About 5,6-dichloropyridin-3-ol
5,6-dichloropyridin-3-ol (PubChem CID 14391672) has the molecular formula C5H3Cl2NO
and a molecular weight of 163.99 g/mol. Its IUPAC name is 5,6-dichloropyridin-3-ol.
Molecular Properties
| Compound Name | 5,6-dichloropyridin-3-ol |
| PubChem CID | 14391672 |
| Molecular Formula | C5H3Cl2NO |
| Molecular Weight | 163.99 g/mol |
| Exact Mass | 162.96 |
| IUPAC Name | 5,6-dichloropyridin-3-ol |
| SMILES | Oc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C5H3Cl2NO/c6-4-1-3(9)2-8-5(4)7/h1-2,9H |
| InChIKey | GMHPKIGFTDRQBP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.99 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloropyridin-3-ol?
The IUPAC name of 5,6-dichloropyridin-3-ol (CID 14391672) is 5,6-dichloropyridin-3-ol.
What is the SMILES notation for 5,6-dichloropyridin-3-ol?
The canonical SMILES for 5,6-dichloropyridin-3-ol is Oc1cnc(Cl)c(Cl)c1.
What is the InChIKey of 5,6-dichloropyridin-3-ol?
The InChIKey is GMHPKIGFTDRQBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2NO/c6-4-1-3(9)2-8-5(4)7/h1-2,9H.
What are the key properties of 5,6-dichloropyridin-3-ol?
5,6-dichloropyridin-3-ol has a molecular weight of 163.99 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloropyridin-3-ol is sourced from PubChem (CID 14391672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).