C23H32N2O2S — CID 143916742
3-[4-[4-(5,6,7,8,9,10-hexahydroheptalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propane-1,2-diol (PubChem CID 143916742) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 3-[4-[4-(5,6,7,8,9,10-hexahydroheptalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-[4-(5,6,7,8,9,10-hexahydroheptalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 143916742 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-[4-[4-(5,6,7,8,9,10-hexahydroheptalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propane-1,2-diol |
| SMILES | OCC(O)CN1CCC(c2nc(C3=CC4=C(CC=C3)CCCCC4)cs2)CC1 |
| InChI | InChI=1S/C23H32N2O2S/c26-15-21(27)14-25-11-9-18(10-12-25)23-24-22(16-28-23)20-8-4-7-17-5-2-1-3-6-19(17)13-20/h4,8,13,16,18,21,26-27H,1-3,5-7,9-12,14-15H2 |
| InChIKey | CSIPWYPEWUKMBJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |