C21H30F4O4 — CID 143916973
[4-(2,3-difluoro-4-formyloxycyclohexyl)-2,6-difluorocyclohexyl] 2-methylprop-2-enoate;2-methylprop-1-ene (PubChem CID 143916973) has the molecular formula C21H30F4O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-formyloxycyclohexyl)-2,6-difluorocyclohexyl] 2-methylprop-2-enoate;2-methylprop-1-ene.
| Compound Name | [4-(2,3-difluoro-4-formyloxycyclohexyl)-2,6-difluorocyclohexyl] 2-methylprop-2-enoate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143916973 |
| Molecular Formula | C21H30F4O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [4-(2,3-difluoro-4-formyloxycyclohexyl)-2,6-difluorocyclohexyl] 2-methylprop-2-enoate;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)C(=O)OC1C(F)CC(C2CCC(OC=O)C(F)C2F)CC1F |
| InChI | InChI=1S/C17H22F4O4.C4H8/c1-8(2)17(23)25-16-11(18)5-9(6-12(16)19)10-3-4-13(24-7-22)15(21)14(10)20;1-4(2)3/h7,9-16H,1,3-6H2,2H3;1H2,2-3H3 |
| InChIKey | AXEASJFLMYBHMN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|