About 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine
2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine (PubChem CID 143917088) has the molecular formula C21H24BrF3N4
and a molecular weight of 469.35 g/mol. Its IUPAC name is 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine |
| PubChem CID | 143917088 |
| Molecular Formula | C21H24BrF3N4 |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine |
| SMILES | CCc1ccc(Br)nc1.CCc1ccc(C(F)(F)F)nc1.CNc1cccnc1 |
| InChI | InChI=1S/C8H8F3N.C7H8BrN.C6H8N2/c1-2-6-3-4-7(12-5-6)8(9,10)11;1-2-6-3-4-7(8)9-5-6;1-7-6-3-2-4-8-5-6/h3-5H,2H2,1H3;3-5H,2H2,1H3;2-5,7H,1H3 |
| InChIKey | AEUSKQZTRYXFPI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine?
The IUPAC name of 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine (CID 143917088) is 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine.
What is the SMILES notation for 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine?
The canonical SMILES for 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine is CCc1ccc(Br)nc1.CCc1ccc(C(F)(F)F)nc1.CNc1cccnc1.
What is the InChIKey of 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine?
The InChIKey is AEUSKQZTRYXFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N.C7H8BrN.C6H8N2/c1-2-6-3-4-7(12-5-6)8(9,10)11;1-2-6-3-4-7(8)9-5-6;1-7-6-3-2-4-8-5-6/h3-5H,2H2,1H3;3-5H,2H2,1H3;2-5,7H,1H3.
What are the key properties of 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine?
2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine has a molecular weight of 469.35 g/mol, XLogP of 6.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-ethylpyridine;5-ethyl-2-(trifluoromethyl)pyridine;N-methylpyridin-3-amine is sourced from PubChem (CID 143917088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).