C21H33N3O2 — CID 143917304
butane;(6R,7R)-6-methyl-7-[(2R)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 143917304) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is butane;(6R,7R)-6-methyl-7-[(2R)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | butane;(6R,7R)-6-methyl-7-[(2R)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 143917304 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | butane;(6R,7R)-6-methyl-7-[(2R)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CCCC.CC[C@H](Cn1cncn1)O[C@@H]1Cc2c(O)cccc2C[C@H]1C |
| InChI | InChI=1S/C17H23N3O2.C4H10/c1-3-14(9-20-11-18-10-19-20)22-17-8-15-13(7-12(17)2)5-4-6-16(15)21;1-3-4-2/h4-6,10-12,14,17,21H,3,7-9H2,1-2H3;3-4H2,1-2H3/t12-,14-,17-;/m1./s1 |
| InChIKey | FIFBHHNOWITADG-YCLOEFEOSA-N |
| XLogP | 4.39 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |