About fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate
fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate (PubChem CID 143917769) has the molecular formula C24H22FNO5
and a molecular weight of 423.44 g/mol. Its IUPAC name is fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate.
Molecular Properties
| Compound Name | fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate |
| PubChem CID | 143917769 |
| Molecular Formula | C24H22FNO5 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate |
| SMILES | Cc1cccc(C)c1-c1cccc(COc2ccc(C(CC(=O)OF)OC=O)cn2)c1 |
| InChI | InChI=1S/C24H22FNO5/c1-16-5-3-6-17(2)24(16)19-8-4-7-18(11-19)14-29-22-10-9-20(13-26-22)21(30-15-27)12-23(28)31-25/h3-11,13,15,21H,12,14H2,1-2H3 |
| InChIKey | RXZIHGHYZCITKH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate?
The IUPAC name of fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate (CID 143917769) is fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate.
What is the SMILES notation for fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate?
The canonical SMILES for fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate is Cc1cccc(C)c1-c1cccc(COc2ccc(C(CC(=O)OF)OC=O)cn2)c1.
What is the InChIKey of fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate?
The InChIKey is RXZIHGHYZCITKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FNO5/c1-16-5-3-6-17(2)24(16)19-8-4-7-18(11-19)14-29-22-10-9-20(13-26-22)21(30-15-27)12-23(28)31-25/h3-11,13,15,21H,12,14H2,1-2H3.
What are the key properties of fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate?
fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate has a molecular weight of 423.44 g/mol, XLogP of 4.98, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3-[6-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-3-pyridinyl]-3-formyloxypropanoate is sourced from PubChem (CID 143917769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).