C22H31N3 — CID 143918128
(1Z,3Z,6E,10Z)-8-imino-N-(methylideneamino)trideca-1,3,6,10-tetraen-1-amine;1,4-xylene (PubChem CID 143918128) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is (1Z,3Z,6E,10Z)-8-imino-N-(methylideneamino)trideca-1,3,6,10-tetraen-1-amine;1,4-xylene.
| Compound Name | (1Z,3Z,6E,10Z)-8-imino-N-(methylideneamino)trideca-1,3,6,10-tetraen-1-amine;1,4-xylene |
|---|---|
| PubChem CID | 143918128 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | (1Z,3Z,6E,10Z)-8-imino-N-(methylideneamino)trideca-1,3,6,10-tetraen-1-amine;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.[H]/N=C(/C=C/C/C=C\C=C/NN=C)C/C=C\CC |
| InChI | InChI=1S/C14H21N3.C8H10/c1-3-4-8-11-14(15)12-9-6-5-7-10-13-17-16-2;1-7-3-5-8(2)6-4-7/h4-5,7-10,12-13,15,17H,2-3,6,11H2,1H3;3-6H,1-2H3/b7-5-,8-4-,12-9+,13-10-,15-14+; |
| InChIKey | VFNVDHJJZMECBF-XFGMITMWSA-N |
| XLogP | 5.89 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|