C23H33NO — CID 143918493
6-(2-cyclohexa-1,5-dien-1-ylethynyl)-2-propyl-1,3-dihydroisoindol-1-ol;ethane (PubChem CID 143918493) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 6-(2-cyclohexa-1,5-dien-1-ylethynyl)-2-propyl-1,3-dihydroisoindol-1-ol;ethane.
| Compound Name | 6-(2-cyclohexa-1,5-dien-1-ylethynyl)-2-propyl-1,3-dihydroisoindol-1-ol;ethane |
|---|---|
| PubChem CID | 143918493 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 6-(2-cyclohexa-1,5-dien-1-ylethynyl)-2-propyl-1,3-dihydroisoindol-1-ol;ethane |
| SMILES | CC.CC.CCCN1Cc2ccc(C#CC3=CCCC=C3)cc2C1O |
| InChI | InChI=1S/C19H21NO.2C2H6/c1-2-12-20-14-17-11-10-16(13-18(17)19(20)21)9-8-15-6-4-3-5-7-15;2*1-2/h4,6-7,10-11,13,19,21H,2-3,5,12,14H2,1H3;2*1-2H3 |
| InChIKey | HQCFNLNRLDXPMT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|