C21H33F2NO8 — CID 143918644
N-[(4aS,8aS)-8,8-difluoro-6-(hydroxymethyl)-7,7-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-4-yl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 143918644) has the molecular formula C21H33F2NO8 and a molecular weight of 465.49 g/mol. Its IUPAC name is N-[(4aS,8aS)-8,8-difluoro-6-(hydroxymethyl)-7,7-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-4-yl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | N-[(4aS,8aS)-8,8-difluoro-6-(hydroxymethyl)-7,7-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-4-yl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 143918644 |
| Molecular Formula | C21H33F2NO8 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[(4aS,8aS)-8,8-difluoro-6-(hydroxymethyl)-7,7-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-4-yl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@](OC)(C(O)C(=O)NC2OCO[C@H]3[C@@H]2OC(CO)C(C)(C)C3(F)F)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C21H33F2NO8/c1-10-7-20(28-6,32-12(3)11(10)2)15(26)17(27)24-18-14-16(29-9-30-18)21(22,23)19(4,5)13(8-25)31-14/h11-16,18,25-26H,1,7-9H2,2-6H3,(H,24,27)/t11-,12-,13?,14+,15?,16+,18?,20-/m1/s1 |
| InChIKey | LARBBWFCFJLRFB-RRGREBFSSA-N |
| XLogP | 0.93 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|