C35H51NO10 — CID 143918660
2-[(4R)-5-[(2R,4R,7S)-3-ethyl-4-hydroxy-7-[(S)-[[(2S)-2-hydroxy-4-phenylbutanoyl]amino]-methoxymethyl]-3-methyloxepan-2-yl]-4-methoxypentyl]-4,6-dihydroxy-3-methylbenzoic acid (PubChem CID 143918660) has the molecular formula C35H51NO10 and a molecular weight of 645.79 g/mol. Its IUPAC name is 2-[(4R)-5-[(2R,4R,7S)-3-ethyl-4-hydroxy-7-[(S)-[[(2S)-2-hydroxy-4-phenylbutanoyl]amino]-methoxymethyl]-3-methyloxepan-2-yl]-4-methoxypentyl]-4,6-dihydroxy-3-methylbenzoic acid.
| Compound Name | 2-[(4R)-5-[(2R,4R,7S)-3-ethyl-4-hydroxy-7-[(S)-[[(2S)-2-hydroxy-4-phenylbutanoyl]amino]-methoxymethyl]-3-methyloxepan-2-yl]-4-methoxypentyl]-4,6-dihydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 143918660 |
| Molecular Formula | C35H51NO10 |
| Molecular Weight | 645.79 g/mol |
| Exact Mass | 645.35 |
| IUPAC Name | 2-[(4R)-5-[(2R,4R,7S)-3-ethyl-4-hydroxy-7-[(S)-[[(2S)-2-hydroxy-4-phenylbutanoyl]amino]-methoxymethyl]-3-methyloxepan-2-yl]-4-methoxypentyl]-4,6-dihydroxy-3-methylbenzoic acid |
| SMILES | CCC1(C)[C@H](O)CC[C@@H]([C@@H](NC(=O)[C@@H](O)CCc2ccccc2)OC)O[C@@H]1C[C@@H](CCCc1c(C)c(O)cc(O)c1C(=O)O)OC |
| InChI | InChI=1S/C35H51NO10/c1-6-35(3)29(40)18-17-28(33(45-5)36-32(41)25(37)16-15-22-11-8-7-9-12-22)46-30(35)19-23(44-4)13-10-14-24-21(2)26(38)20-27(39)31(24)34(42)43/h7-9,11-12,20,23,25,28-30,33,37-40H,6,10,13-19H2,1-5H3,(H,36,41)(H,42,43)/t23-,25+,28+,29-,30-,33+,35?/m1/s1 |
| InChIKey | SXNFUGMKWARWKY-IDKOOTSYSA-N |
| XLogP | 4.24 |
| TPSA | 175.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|