C25H43F2NO7 — CID 143918721
(2S)-N-[1-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4,4-difluoro-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 143918721) has the molecular formula C25H43F2NO7 and a molecular weight of 507.62 g/mol. Its IUPAC name is (2S)-N-[1-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4,4-difluoro-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | (2S)-N-[1-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4,4-difluoro-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 143918721 |
| Molecular Formula | C25H43F2NO7 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | (2S)-N-[1-[(2S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4,4-difluoro-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@](OC)([C@H](O)C(=O)NC(C)[C@@H]2CC(F)(F)C(C)(C)[C@@H](C[C@@H](COC)OC)O2)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H43F2NO7/c1-14-11-24(33-9,35-17(4)15(14)2)21(29)22(30)28-16(3)19-12-25(26,27)23(5,6)20(34-19)10-18(32-8)13-31-7/h15-21,29H,1,10-13H2,2-9H3,(H,28,30)/t15-,16?,17-,18+,19+,20-,21-,24-/m1/s1 |
| InChIKey | HZBFMFSUUXCYNE-KOCLOVPASA-N |
| XLogP | 3.07 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|