C29H28Cl2NNaO5 — CID 143918994
sodium;6-chloro-7-(4-methylphenoxy)-3,4-dihydro-2H-chromene-4-carboxylate;N-[3-(4-chlorophenyl)cyclopentyl]formamide (PubChem CID 143918994) has the molecular formula C29H28Cl2NNaO5 and a molecular weight of 564.44 g/mol. Its IUPAC name is sodium;6-chloro-7-(4-methylphenoxy)-3,4-dihydro-2H-chromene-4-carboxylate;N-[3-(4-chlorophenyl)cyclopentyl]formamide.
| Compound Name | sodium;6-chloro-7-(4-methylphenoxy)-3,4-dihydro-2H-chromene-4-carboxylate;N-[3-(4-chlorophenyl)cyclopentyl]formamide |
|---|---|
| PubChem CID | 143918994 |
| Molecular Formula | C29H28Cl2NNaO5 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | sodium;6-chloro-7-(4-methylphenoxy)-3,4-dihydro-2H-chromene-4-carboxylate;N-[3-(4-chlorophenyl)cyclopentyl]formamide |
| SMILES | Cc1ccc(Oc2cc3c(cc2Cl)C(C(=O)[O-])CCO3)cc1.O=CNC1CCC(c2ccc(Cl)cc2)C1.[Na+] |
| InChI | InChI=1S/C17H15ClO4.C12H14ClNO.Na/c1-10-2-4-11(5-3-10)22-16-9-15-13(8-14(16)18)12(17(19)20)6-7-21-15;13-11-4-1-9(2-5-11)10-3-6-12(7-10)14-8-15;/h2-5,8-9,12H,6-7H2,1H3,(H,19,20);1-2,4-5,8,10,12H,3,6-7H2,(H,14,15);/q;;+1/p-1 |
| InChIKey | GTJKAPFURAAJJI-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|