About 2-methoxy-1,2-dihydropyridin-5-amine
2-methoxy-1,2-dihydropyridin-5-amine (PubChem CID 143919218) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-methoxy-1,2-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | 2-methoxy-1,2-dihydropyridin-5-amine |
| PubChem CID | 143919218 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2-methoxy-1,2-dihydropyridin-5-amine |
| SMILES | COC1C=CC(N)=CN1 |
| InChI | InChI=1S/C6H10N2O/c1-9-6-3-2-5(7)4-8-6/h2-4,6,8H,7H2,1H3 |
| InChIKey | FFOMYMKPEHIPBH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1,2-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,2-dihydropyridin-5-amine?
The IUPAC name of 2-methoxy-1,2-dihydropyridin-5-amine (CID 143919218) is 2-methoxy-1,2-dihydropyridin-5-amine.
What is the SMILES notation for 2-methoxy-1,2-dihydropyridin-5-amine?
The canonical SMILES for 2-methoxy-1,2-dihydropyridin-5-amine is COC1C=CC(N)=CN1.
What is the InChIKey of 2-methoxy-1,2-dihydropyridin-5-amine?
The InChIKey is FFOMYMKPEHIPBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-9-6-3-2-5(7)4-8-6/h2-4,6,8H,7H2,1H3.
What are the key properties of 2-methoxy-1,2-dihydropyridin-5-amine?
2-methoxy-1,2-dihydropyridin-5-amine has a molecular weight of 126.16 g/mol, XLogP of -0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,2-dihydropyridin-5-amine is sourced from PubChem (CID 143919218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).