About ethane;(2R)-2-(2-methylphenoxy)butanoic acid
ethane;(2R)-2-(2-methylphenoxy)butanoic acid (PubChem CID 143919968) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is ethane;(2R)-2-(2-methylphenoxy)butanoic acid.
Molecular Properties
| Compound Name | ethane;(2R)-2-(2-methylphenoxy)butanoic acid |
| PubChem CID | 143919968 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethane;(2R)-2-(2-methylphenoxy)butanoic acid |
| SMILES | CC.CC[C@@H](Oc1ccccc1C)C(=O)O |
| InChI | InChI=1S/C11H14O3.C2H6/c1-3-9(11(12)13)14-10-7-5-4-6-8(10)2;1-2/h4-7,9H,3H2,1-2H3,(H,12,13);1-2H3/t9-;/m1./s1 |
| InChIKey | ANQDMHZAKWESMZ-SBSPUUFOSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(2R)-2-(2-methylphenoxy)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2R)-2-(2-methylphenoxy)butanoic acid?
The IUPAC name of ethane;(2R)-2-(2-methylphenoxy)butanoic acid (CID 143919968) is ethane;(2R)-2-(2-methylphenoxy)butanoic acid.
What is the SMILES notation for ethane;(2R)-2-(2-methylphenoxy)butanoic acid?
The canonical SMILES for ethane;(2R)-2-(2-methylphenoxy)butanoic acid is CC.CC[C@@H](Oc1ccccc1C)C(=O)O.
What is the InChIKey of ethane;(2R)-2-(2-methylphenoxy)butanoic acid?
The InChIKey is ANQDMHZAKWESMZ-SBSPUUFOSA-N. The full InChI is InChI=1S/C11H14O3.C2H6/c1-3-9(11(12)13)14-10-7-5-4-6-8(10)2;1-2/h4-7,9H,3H2,1-2H3,(H,12,13);1-2H3/t9-;/m1./s1.
What are the key properties of ethane;(2R)-2-(2-methylphenoxy)butanoic acid?
ethane;(2R)-2-(2-methylphenoxy)butanoic acid has a molecular weight of 224.30 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2R)-2-(2-methylphenoxy)butanoic acid is sourced from PubChem (CID 143919968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).