About N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide
N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide (PubChem CID 143920154) has the molecular formula C11H16F2N6
and a molecular weight of 270.29 g/mol. Its IUPAC name is N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide.
Molecular Properties
| Compound Name | N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide |
| PubChem CID | 143920154 |
| Molecular Formula | C11H16F2N6 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide |
| SMILES | N/C=N\N(N)C1CCN(c2c(F)cc(N)cc2F)C1 |
| InChI | InChI=1S/C11H16F2N6/c12-9-3-7(15)4-10(13)11(9)18-2-1-8(5-18)19(16)17-6-14/h3-4,6,8H,1-2,5,15-16H2,(H2,14,17) |
| InChIKey | XFZVHSLRUDTGSX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide?
The IUPAC name of N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide (CID 143920154) is N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide.
What is the SMILES notation for N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide?
The canonical SMILES for N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide is N/C=N\N(N)C1CCN(c2c(F)cc(N)cc2F)C1.
What is the InChIKey of N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide?
The InChIKey is XFZVHSLRUDTGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N6/c12-9-3-7(15)4-10(13)11(9)18-2-1-8(5-18)19(16)17-6-14/h3-4,6,8H,1-2,5,15-16H2,(H2,14,17).
What are the key properties of N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide?
N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide has a molecular weight of 270.29 g/mol, XLogP of 0.20, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[amino-[1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]amino]methanimidamide is sourced from PubChem (CID 143920154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).