About 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane
2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane (PubChem CID 143920284) has the molecular formula C26H63N4+3
and a molecular weight of 431.82 g/mol. Its IUPAC name is 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane.
Molecular Properties
| Compound Name | 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane |
| PubChem CID | 143920284 |
| Molecular Formula | C26H63N4+3 |
| Molecular Weight | 431.82 g/mol |
| Exact Mass | 431.50 |
| IUPAC Name | 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane |
| SMILES | CC.CCCC[N+](C)(C)CCN(CC[N+](C)(C)CCCC)CC[N+](C)(C)CCCC |
| InChI | InChI=1S/C24H57N4.C2H6/c1-10-13-19-26(4,5)22-16-25(17-23-27(6,7)20-14-11-2)18-24-28(8,9)21-15-12-3;1-2/h10-24H2,1-9H3;1-2H3/q+3; |
| InChIKey | HZMUALOJIOYXML-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane?
The IUPAC name of 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane (CID 143920284) is 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane.
What is the SMILES notation for 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane?
The canonical SMILES for 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane is CC.CCCC[N+](C)(C)CCN(CC[N+](C)(C)CCCC)CC[N+](C)(C)CCCC.
What is the InChIKey of 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane?
The InChIKey is HZMUALOJIOYXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H57N4.C2H6/c1-10-13-19-26(4,5)22-16-25(17-23-27(6,7)20-14-11-2)18-24-28(8,9)21-15-12-3;1-2/h10-24H2,1-9H3;1-2H3/q+3;.
What are the key properties of 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane?
2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane has a molecular weight of 431.82 g/mol, XLogP of 4.94, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[2-[butyl(dimethyl)azaniumyl]ethyl]amino]ethyl-butyl-dimethylazanium;ethane is sourced from PubChem (CID 143920284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).