C18H36N6O2+2 — CID 143920290
dimethyl-[6-[methyl-[3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]propyl]azaniumyl]hexyl]azanium (PubChem CID 143920290) has the molecular formula C18H36N6O2+2 and a molecular weight of 368.53 g/mol. Its IUPAC name is dimethyl-[6-[methyl-[3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]propyl]azaniumyl]hexyl]azanium.
| Compound Name | dimethyl-[6-[methyl-[3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]propyl]azaniumyl]hexyl]azanium |
|---|---|
| PubChem CID | 143920290 |
| Molecular Formula | C18H36N6O2+2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | dimethyl-[6-[methyl-[3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]propyl]azaniumyl]hexyl]azanium |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCCC[NH+](C)CCCCCC[NH+](C)C)n1 |
| InChI | InChI=1S/C18H34N6O2/c1-15-14-16(25)21-17(20-15)22-18(26)19-10-9-13-24(4)12-8-6-5-7-11-23(2)3/h14H,5-13H2,1-4H3,(H3,19,20,21,22,25,26)/p+2 |
| InChIKey | WSJXNBDTEXYJPU-UHFFFAOYSA-P |
| XLogP | -1.19 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|