C17H33N5O2 — CID 143920293
ethane;1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-[3-[methyl(pentyl)amino]propyl]urea (PubChem CID 143920293) has the molecular formula C17H33N5O2 and a molecular weight of 339.48 g/mol. Its IUPAC name is ethane;1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-[3-[methyl(pentyl)amino]propyl]urea.
| Compound Name | ethane;1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-[3-[methyl(pentyl)amino]propyl]urea |
|---|---|
| PubChem CID | 143920293 |
| Molecular Formula | C17H33N5O2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | ethane;1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-[3-[methyl(pentyl)amino]propyl]urea |
| SMILES | CC.CCCCCN(C)CCCNC(=O)Nc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H27N5O2.C2H6/c1-4-5-6-9-20(3)10-7-8-16-15(22)19-14-17-12(2)11-13(21)18-14;1-2/h11H,4-10H2,1-3H3,(H3,16,17,18,19,21,22);1-2H3 |
| InChIKey | CXEWKSQNEFTVPY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|