About ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine
ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine (PubChem CID 143920429) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine.
Molecular Properties
| Compound Name | ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine |
| PubChem CID | 143920429 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine |
| SMILES | CC.CNC.COc1cccc(C=O)c1N1CCCC1 |
| InChI | InChI=1S/C12H15NO2.C2H7N.C2H6/c1-15-11-6-4-5-10(9-14)12(11)13-7-2-3-8-13;1-3-2;1-2/h4-6,9H,2-3,7-8H2,1H3;3H,1-2H3;1-2H3 |
| InChIKey | RUDNVDLYSLWJKJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine?
The IUPAC name of ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine (CID 143920429) is ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine.
What is the SMILES notation for ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine?
The canonical SMILES for ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine is CC.CNC.COc1cccc(C=O)c1N1CCCC1.
What is the InChIKey of ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine?
The InChIKey is RUDNVDLYSLWJKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2.C2H7N.C2H6/c1-15-11-6-4-5-10(9-14)12(11)13-7-2-3-8-13;1-3-2;1-2/h4-6,9H,2-3,7-8H2,1H3;3H,1-2H3;1-2H3.
What are the key properties of ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine?
ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine has a molecular weight of 280.41 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxy-2-pyrrolidin-1-ylbenzaldehyde;N-methylmethanamine is sourced from PubChem (CID 143920429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).