About (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol
(3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol (PubChem CID 143920611) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol.
Molecular Properties
| Compound Name | (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol |
| PubChem CID | 143920611 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)/C=N/N |
| InChI | InChI=1S/C7H10N2O/c1-6(5-9-8)3-4-7(2)10/h3-5,10H,1-2,8H2/b4-3-,9-5+ |
| InChIKey | CKVVDFMEPZVWFJ-XBURUKCPSA-N |
| XLogP | 1.12 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol?
The IUPAC name of (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol (CID 143920611) is (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol.
What is the SMILES notation for (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol?
The canonical SMILES for (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol is C=C(O)/C=C\C(=C)/C=N/N.
What is the InChIKey of (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol?
The InChIKey is CKVVDFMEPZVWFJ-XBURUKCPSA-N. The full InChI is InChI=1S/C7H10N2O/c1-6(5-9-8)3-4-7(2)10/h3-5,10H,1-2,8H2/b4-3-,9-5+.
What are the key properties of (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol?
(3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol has a molecular weight of 138.17 g/mol, XLogP of 1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol is sourced from PubChem (CID 143920611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).