About cobalt;1,1-difluorocyclopropane
cobalt;1,1-difluorocyclopropane (PubChem CID 143921033) has the molecular formula C3H4CoF2
and a molecular weight of 136.99 g/mol. Its IUPAC name is cobalt;1,1-difluorocyclopropane.
Molecular Properties
| Compound Name | cobalt;1,1-difluorocyclopropane |
| PubChem CID | 143921033 |
| Molecular Formula | C3H4CoF2 |
| Molecular Weight | 136.99 g/mol |
| Exact Mass | 136.96 |
| IUPAC Name | cobalt;1,1-difluorocyclopropane |
| SMILES | FC1(F)CC1.[Co] |
| InChI | InChI=1S/C3H4F2.Co/c4-3(5)1-2-3;/h1-2H2; |
| InChIKey | GOICYNPDHPGBTF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.99 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cobalt;1,1-difluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;1,1-difluorocyclopropane?
The IUPAC name of cobalt;1,1-difluorocyclopropane (CID 143921033) is cobalt;1,1-difluorocyclopropane.
What is the SMILES notation for cobalt;1,1-difluorocyclopropane?
The canonical SMILES for cobalt;1,1-difluorocyclopropane is FC1(F)CC1.[Co].
What is the InChIKey of cobalt;1,1-difluorocyclopropane?
The InChIKey is GOICYNPDHPGBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F2.Co/c4-3(5)1-2-3;/h1-2H2;.
What are the key properties of cobalt;1,1-difluorocyclopropane?
cobalt;1,1-difluorocyclopropane has a molecular weight of 136.99 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;1,1-difluorocyclopropane is sourced from PubChem (CID 143921033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).