C13H24N2O2S — CID 143922062
(3E,5E)-7-amino-N-tert-butyl-5,6-dimethylhepta-1,3,5-triene-3-sulfonamide (PubChem CID 143922062) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is (3E,5E)-7-amino-N-tert-butyl-5,6-dimethylhepta-1,3,5-triene-3-sulfonamide.
| Compound Name | (3E,5E)-7-amino-N-tert-butyl-5,6-dimethylhepta-1,3,5-triene-3-sulfonamide |
|---|---|
| PubChem CID | 143922062 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (3E,5E)-7-amino-N-tert-butyl-5,6-dimethylhepta-1,3,5-triene-3-sulfonamide |
| SMILES | C=C/C(=C\C(C)=C(/C)CN)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H24N2O2S/c1-7-12(8-10(2)11(3)9-14)18(16,17)15-13(4,5)6/h7-8,15H,1,9,14H2,2-6H3/b11-10+,12-8+ |
| InChIKey | ANNULHZUJQOKBE-HKCCEGKBSA-N |
| XLogP | 2.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|