About 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane
4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane (PubChem CID 143922284) has the molecular formula C11H20N2OS
and a molecular weight of 228.36 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane.
Molecular Properties
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane |
| PubChem CID | 143922284 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane |
| SMILES | CC.Cc1nc(N2CCOCC2)sc1C |
| InChI | InChI=1S/C9H14N2OS.C2H6/c1-7-8(2)13-9(10-7)11-3-5-12-6-4-11;1-2/h3-6H2,1-2H3;1-2H3 |
| InChIKey | ZSBDYRAYIFZFCC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane?
The IUPAC name of 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane (CID 143922284) is 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane.
What is the SMILES notation for 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane?
The canonical SMILES for 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane is CC.Cc1nc(N2CCOCC2)sc1C.
What is the InChIKey of 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane?
The InChIKey is ZSBDYRAYIFZFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS.C2H6/c1-7-8(2)13-9(10-7)11-3-5-12-6-4-11;1-2/h3-6H2,1-2H3;1-2H3.
What are the key properties of 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane?
4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane has a molecular weight of 228.36 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethyl-1,3-thiazol-2-yl)morpholine;ethane is sourced from PubChem (CID 143922284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).