About 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine
4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine (PubChem CID 143922304) has the molecular formula C12H17F2NO
and a molecular weight of 229.27 g/mol. Its IUPAC name is 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine |
| PubChem CID | 143922304 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine |
| SMILES | C=C(C)/C(=C\C(=C)N1CCOCC1)C(F)F |
| InChI | InChI=1S/C12H17F2NO/c1-9(2)11(12(13)14)8-10(3)15-4-6-16-7-5-15/h8,12H,1,3-7H2,2H3/b11-8+ |
| InChIKey | GXKJBHMUFQGWBF-DHZHZOJOSA-N |
| XLogP | 2.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine?
The IUPAC name of 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine (CID 143922304) is 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine.
What is the SMILES notation for 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine?
The canonical SMILES for 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine is C=C(C)/C(=C\C(=C)N1CCOCC1)C(F)F.
What is the InChIKey of 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine?
The InChIKey is GXKJBHMUFQGWBF-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H17F2NO/c1-9(2)11(12(13)14)8-10(3)15-4-6-16-7-5-15/h8,12H,1,3-7H2,2H3/b11-8+.
What are the key properties of 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine?
4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine has a molecular weight of 229.27 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-4-(difluoromethyl)-5-methylhexa-1,3,5-trien-2-yl]morpholine is sourced from PubChem (CID 143922304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).