C24H20F3N3O3 — CID 143922361
2-[2-(difluoromethyl)-4-fluorophenyl]-N-[3-(3-hydroxypropoxy)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 143922361) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-4-fluorophenyl]-N-[3-(3-hydroxypropoxy)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[2-(difluoromethyl)-4-fluorophenyl]-N-[3-(3-hydroxypropoxy)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 143922361 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[2-(difluoromethyl)-4-fluorophenyl]-N-[3-(3-hydroxypropoxy)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(OCCCO)c1)c1cccc2[nH]c(-c3ccc(F)cc3C(F)F)nc12 |
| InChI | InChI=1S/C24H20F3N3O3/c25-14-8-9-17(19(12-14)22(26)27)23-29-20-7-2-6-18(21(20)30-23)24(32)28-15-4-1-5-16(13-15)33-11-3-10-31/h1-2,4-9,12-13,22,31H,3,10-11H2,(H,28,32)(H,29,30) |
| InChIKey | RFMPMQQKOKOILS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|