C22H45N5 — CID 143922562
(1Z,3Z,5E)-5-[(E)-N-(1-aminoethenyl)-C-[(Z)-prop-1-enyl]carbonimidoyl]-3-N,3-N,4-trimethylhexa-1,3,5-triene-1,3,6-triamine;ethane;propane (PubChem CID 143922562) has the molecular formula C22H45N5 and a molecular weight of 379.64 g/mol. Its IUPAC name is (1Z,3Z,5E)-5-[(E)-N-(1-aminoethenyl)-C-[(Z)-prop-1-enyl]carbonimidoyl]-3-N,3-N,4-trimethylhexa-1,3,5-triene-1,3,6-triamine;ethane;propane.
| Compound Name | (1Z,3Z,5E)-5-[(E)-N-(1-aminoethenyl)-C-[(Z)-prop-1-enyl]carbonimidoyl]-3-N,3-N,4-trimethylhexa-1,3,5-triene-1,3,6-triamine;ethane;propane |
|---|---|
| PubChem CID | 143922562 |
| Molecular Formula | C22H45N5 |
| Molecular Weight | 379.64 g/mol |
| Exact Mass | 379.37 |
| IUPAC Name | (1Z,3Z,5E)-5-[(E)-N-(1-aminoethenyl)-C-[(Z)-prop-1-enyl]carbonimidoyl]-3-N,3-N,4-trimethylhexa-1,3,5-triene-1,3,6-triamine;ethane;propane |
| SMILES | C=C(N)/N=C(\C=C/C)C(=CN)/C(C)=C(/C=C\N)N(C)C.CC.CC.CCC |
| InChI | InChI=1S/C15H25N5.C3H8.2C2H6/c1-6-7-14(19-12(3)18)13(10-17)11(2)15(8-9-16)20(4)5;1-3-2;2*1-2/h6-10H,3,16-18H2,1-2,4-5H3;3H2,1-2H3;2*1-2H3/b7-6-,9-8-,13-10+,15-11-,19-14+;;; |
| InChIKey | AQJOOWZYFWXIDR-NCFWBQPJSA-N |
| XLogP | 5.05 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|