About ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one
ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 143923276) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 143923276 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC.[H]/N=C1\CCCn2c1nc(C)c(CC)c2=O |
| InChI | InChI=1S/C11H15N3O.C2H6/c1-3-8-7(2)13-10-9(12)5-4-6-14(10)11(8)15;1-2/h12H,3-6H2,1-2H3;1-2H3/b12-9+; |
| InChIKey | DMDZMOWNXMGEMH-NBYYMMLRSA-N |
| XLogP | 2.30 |
| TPSA | 58.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (CID 143923276) is ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one is CC.[H]/N=C1\CCCn2c1nc(C)c(CC)c2=O.
What is the InChIKey of ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is DMDZMOWNXMGEMH-NBYYMMLRSA-N. The full InChI is InChI=1S/C11H15N3O.C2H6/c1-3-8-7(2)13-10-9(12)5-4-6-14(10)11(8)15;1-2/h12H,3-6H2,1-2H3;1-2H3/b12-9+;.
What are the key properties of ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one?
ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 235.33 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-9-imino-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 143923276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).