C22H35N5O3 — CID 143923599
ethyl 6-[3-[1-[(Z)-(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]propylamino]-2-methylpyridine-3-carboxylate (PubChem CID 143923599) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl 6-[3-[1-[(Z)-(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]propylamino]-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 6-[3-[1-[(Z)-(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]propylamino]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 143923599 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | ethyl 6-[3-[1-[(Z)-(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]propylamino]-2-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCCCC2CCN(C(=O)/N=C(\N)C(C)C)CC2)nc1C |
| InChI | InChI=1S/C22H35N5O3/c1-5-30-21(28)18-8-9-19(25-16(18)4)24-12-6-7-17-10-13-27(14-11-17)22(29)26-20(23)15(2)3/h8-9,15,17H,5-7,10-14H2,1-4H3,(H,24,25)(H2,23,26,29) |
| InChIKey | DVYUCVDRWATSMU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|