About ethane;3,4,5-trimethyl-2H-pyrrole
ethane;3,4,5-trimethyl-2H-pyrrole (PubChem CID 143924244) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is ethane;3,4,5-trimethyl-2H-pyrrole.
Molecular Properties
| Compound Name | ethane;3,4,5-trimethyl-2H-pyrrole |
| PubChem CID | 143924244 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | ethane;3,4,5-trimethyl-2H-pyrrole |
| SMILES | CC.CC1=NCC(C)=C1C |
| InChI | InChI=1S/C7H11N.C2H6/c1-5-4-8-7(3)6(5)2;1-2/h4H2,1-3H3;1-2H3 |
| InChIKey | FJPMWLHGCRFTSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3,4,5-trimethyl-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3,4,5-trimethyl-2H-pyrrole?
The IUPAC name of ethane;3,4,5-trimethyl-2H-pyrrole (CID 143924244) is ethane;3,4,5-trimethyl-2H-pyrrole.
What is the SMILES notation for ethane;3,4,5-trimethyl-2H-pyrrole?
The canonical SMILES for ethane;3,4,5-trimethyl-2H-pyrrole is CC.CC1=NCC(C)=C1C.
What is the InChIKey of ethane;3,4,5-trimethyl-2H-pyrrole?
The InChIKey is FJPMWLHGCRFTSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C2H6/c1-5-4-8-7(3)6(5)2;1-2/h4H2,1-3H3;1-2H3.
What are the key properties of ethane;3,4,5-trimethyl-2H-pyrrole?
ethane;3,4,5-trimethyl-2H-pyrrole has a molecular weight of 139.24 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3,4,5-trimethyl-2H-pyrrole is sourced from PubChem (CID 143924244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).